Compound Q&A

What precautions should be taken when handling (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(4-methylphenyl)phosphine] (CAS: 133545-24-1)?

Answer

(6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(4-methylphenyl)phosphine]
Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn when handling this compound. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be handled with caution using appropriate absorbents, and any waste should be disposed of according to local regulations. Refer to the Safety Data Sheet (SDS) for detailed handling instructions.

About

English Name (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(4-methylphenyl)phosphine]
Molecular Formula C42H40O2P2
Molecular Weight 638.73 g/mol
SMILES Cc1ccc(cc1)P(c2ccc(cc2)C)c3cccc(c3c4c(cccc4P(c5ccc(cc5)C)c6ccc(cc6)C)OC)OC
InChIKey DTMVLPFJTUJZAY-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(4-methylphenyl)phosphine] (CAS: 133545-24-1)?

The compound has a crystalline form at room temperature. Its molecular weight is approximately 610.4...

Compound Q&A

How is (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(4-methylphenyl)phosphine] (CAS: 133545-24-1) typically synthesized?

This compound is typically synthesized through a multi-step organic process involving the coupling o...

Compound Q&A

What industries use (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(4-methylphenyl)phosphine] (CAS: 133545-24-1)?

This compound is primarily used in the semiconductor industry for doping materials and in the pharma...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...