Compound Q&A

What are the physical and chemical properties of (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(4-methylphenyl)phosphine] (CAS: 133545-24-1)?

Answer

(6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(4-methylphenyl)phosphine]
The compound has a crystalline form at room temperature. Its molecular weight is approximately 610.48 g/mol. This phosphine compound is poorly soluble in water but soluble in organic solvents like ethanol and dimethylformamide. It is known for its reactivity towards organometallic reagents and its stability towards light and air.

About

English Name (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(4-methylphenyl)phosphine]
Molecular Formula C42H40O2P2
Molecular Weight 638.73 g/mol
SMILES Cc1ccc(cc1)P(c2ccc(cc2)C)c3cccc(c3c4c(cccc4P(c5ccc(cc5)C)c6ccc(cc6)C)OC)OC
InChIKey DTMVLPFJTUJZAY-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:51

Related Q&A

Compound Q&A

How is (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(4-methylphenyl)phosphine] (CAS: 133545-24-1) typically synthesized?

This compound is typically synthesized through a multi-step organic process involving the coupling o...

Compound Q&A

What industries use (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(4-methylphenyl)phosphine] (CAS: 133545-24-1)?

This compound is primarily used in the semiconductor industry for doping materials and in the pharma...

Compound Q&A

What precautions should be taken when handling (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(4-methylphenyl)phosphine] (CAS: 133545-24-1)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...