Compound Q&A

How is (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(4-methylphenyl)phosphine] (CAS: 133545-24-1) typically synthesized?

Answer

(6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(4-methylphenyl)phosphine]
This compound is typically synthesized through a multi-step organic process involving the coupling of 4-methylphenylphosphine with 6,6'-dimethoxy-2,2'-biphenyldiyl dihalide. The synthesis requires careful control of reaction conditions to achieve high yields and selectivity. Commonly used catalysts include palladium(II) acetate and tri-ortho-tolylphosphine.

About

English Name (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(4-methylphenyl)phosphine]
Molecular Formula C42H40O2P2
Molecular Weight 638.73 g/mol
SMILES Cc1ccc(cc1)P(c2ccc(cc2)C)c3cccc(c3c4c(cccc4P(c5ccc(cc5)C)c6ccc(cc6)C)OC)OC
InChIKey DTMVLPFJTUJZAY-UHFFFAOYSA-N
Last Updated: 2026-01-07 05:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(4-methylphenyl)phosphine] (CAS: 133545-24-1)?

The compound has a crystalline form at room temperature. Its molecular weight is approximately 610.4...

Compound Q&A

What industries use (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(4-methylphenyl)phosphine] (CAS: 133545-24-1)?

This compound is primarily used in the semiconductor industry for doping materials and in the pharma...

Compound Q&A

What precautions should be taken when handling (6,6'-Dimethoxy-2,2'-biphenyldiyl)bis[bis(4-methylphenyl)phosphine] (CAS: 133545-24-1)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...