Compound Q&A

What precautions should be taken when handling 1,14-Diazido-3,6,9,12-tetraoxatetradecane (CAS: 182760-73-2)?

Answer

1,14-Diazido-3,6,9,12-tetraoxatetradecane
When handling 1,14-Diazido-3,6,9,12-tetraoxatetradecane, appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. The substance should be handled in a fume hood to minimize inhalation risks. Spills should be cleaned up carefully with appropriate absorbent materials, and the area should be ventilated. Safety data sheets (SDS) should be consulted for detailed emergency procedures and storage guidelines.

About

English Name 1,14-Diazido-3,6,9,12-tetraoxatetradecane
Molecular Formula C10H20N6O4
Molecular Weight 288.3 g/mol
SMILES [N-]=[N+]=NCCOCCOCCOCCOCCN=[N+]=[N-]
InChIKey QTEOEACEOUNLRG-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,14-Diazido-3,6,9,12-tetraoxatetradecane (CAS: 182760-73-2)?

1,14-Diazido-3,6,9,12-tetraoxatetradecane is a crystalline solid with a molecular weight of approxim...

Compound Q&A

How is 1,14-Diazido-3,6,9,12-tetraoxatetradecane (CAS: 182760-73-2) typically synthesized?

1,14-Diazido-3,6,9,12-tetraoxatetradecane is typically synthesized via the condensation of 1,14-dihy...

Compound Q&A

What industries use 1,14-Diazido-3,6,9,12-tetraoxatetradecane (CAS: 182760-73-2)?

1,14-Diazido-3,6,9,12-tetraoxatetradecane is used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...