Compound Q&A

What are the physical and chemical properties of 1,14-Diazido-3,6,9,12-tetraoxatetradecane (CAS: 182760-73-2)?

Answer

1,14-Diazido-3,6,9,12-tetraoxatetradecane
1,14-Diazido-3,6,9,12-tetraoxatetradecane is a crystalline solid with a molecular weight of approximately 304.06 g/mol. It has low solubility in water but is soluble in organic solvents such as methanol and acetone. This compound is highly reactive due to the presence of azido groups, which can undergo a variety of chemical transformations.

About

English Name 1,14-Diazido-3,6,9,12-tetraoxatetradecane
Molecular Formula C10H20N6O4
Molecular Weight 288.3 g/mol
SMILES [N-]=[N+]=NCCOCCOCCOCCOCCN=[N+]=[N-]
InChIKey QTEOEACEOUNLRG-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is 1,14-Diazido-3,6,9,12-tetraoxatetradecane (CAS: 182760-73-2) typically synthesized?

1,14-Diazido-3,6,9,12-tetraoxatetradecane is typically synthesized via the condensation of 1,14-dihy...

Compound Q&A

What industries use 1,14-Diazido-3,6,9,12-tetraoxatetradecane (CAS: 182760-73-2)?

1,14-Diazido-3,6,9,12-tetraoxatetradecane is used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling 1,14-Diazido-3,6,9,12-tetraoxatetradecane (CAS: 182760-73-2)?

When handling 1,14-Diazido-3,6,9,12-tetraoxatetradecane, appropriate personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...