Compound Q&A

What industries use Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5)?

Answer

Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate
Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5) is used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It also finds applications in the polymer industry for developing functional materials. Additionally, it is used in the production of sensors and in semiconductor applications due to its chemical and physical properties.

About

English Name Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate
Molecular Formula C11H13NO2
Molecular Weight 191.23 g/mol
SMILES COC(=O)C1=CC2=C(CNCC2)C=C1
InChIKey QFGFDECCVRJKHK-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5)?

Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5) is a solid crystalline compou...

Compound Q&A

How is Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5) typically synthesized?

Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5) can be synthesized through a ...

Compound Q&A

What precautions should be taken when handling Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5)?

When handling Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5), proper persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...