Compound Q&A

How is Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5) typically synthesized?

Answer

Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate
Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5) can be synthesized through a multi-step reaction starting with 6-isoquinolinecarboxylic acid. This involves esterification with methanol under mild conditions using a catalytic amount of a strong acid like sulfuric acid. The yield and selectivity are typically high, making this a reliable method for preparing this compound.

About

English Name Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate
Molecular Formula C11H13NO2
Molecular Weight 191.23 g/mol
SMILES COC(=O)C1=CC2=C(CNCC2)C=C1
InChIKey QFGFDECCVRJKHK-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5)?

Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5) is a solid crystalline compou...

Compound Q&A

What industries use Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5)?

Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5) is used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5)?

When handling Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5), proper persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...