Compound Q&A

What are the physical and chemical properties of Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5)?

Answer

Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate
Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5) is a solid crystalline compound with a molecular weight of approximately 227.23 g/mol. It is soluble in organic solvents such as ethanol and acetone. This compound is relatively stable under normal conditions but can undergo hydrolysis in acidic or basic media. Care must be taken when handling due to its potential reactivity.

About

English Name Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate
Molecular Formula C11H13NO2
Molecular Weight 191.23 g/mol
SMILES COC(=O)C1=CC2=C(CNCC2)C=C1
InChIKey QFGFDECCVRJKHK-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5) typically synthesized?

Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5) can be synthesized through a ...

Compound Q&A

What industries use Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5)?

Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5) is used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5)?

When handling Methyl 1,2,3,4-tetrahydro-6-isoquinolinecarboxylate (CAS: 185057-00-5), proper persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...