Compound Q&A

What industries use Nitro(~13~C_6_)benzene (CAS: 89059-37-0)?

Answer

Nitro(~13~C_6_)benzene
Nitro(~13~C_6_)benzene (CAS: 89059-37-0) is used in various industries including pharmaceuticals, where it serves as a precursor for the synthesis of certain drugs. It is also used in the production of dyes, plastics, and as a reagent in organic synthesis.

About

CAS No 89059-37-0
English Name Nitro(~13~C_6_)benzene
Molecular Formula 13C6H5NO2
Molecular Weight 129.07 g/mol
SMILES C1=CC=C(C=C1)[N+](=O)[O-]
InChIKey LQNUZADURLCDLV-IDEBNGHGSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Nitro(~13~C_6_)benzene (CAS: 89059-37-0)?

Nitro(~13~C_6_)benzene (CAS: 89059-37-0) is a crystalline compound with a molecular weight of approx...

Compound Q&A

How is Nitro(~13~C_6_)benzene (CAS: 89059-37-0) typically synthesized?

Nitro(~13~C_6_)benzene (CAS: 89059-37-0) is typically synthesized by the nitration of toluene with c...

Compound Q&A

What precautions should be taken when handling Nitro(~13~C_6_)benzene (CAS: 89059-37-0)?

When handling Nitro(~13~C_6_)benze (CAS: 89059-37-0), it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...