Compound Q&A

What are the physical and chemical properties of Nitro(~13~C_6_)benzene (CAS: 89059-37-0)?

Answer

Nitro(~13~C_6_)benzene
Nitro(~13~C_6_)benzene (CAS: 89059-37-0) is a crystalline compound with a molecular weight of approximately 150.12 g/mol. It has a low solubility in water but is soluble in organic solvents such as benzene and toluene. The compound is known for its high reactivity towards nucleophilic substitution and reduction reactions.

About

CAS No 89059-37-0
English Name Nitro(~13~C_6_)benzene
Molecular Formula 13C6H5NO2
Molecular Weight 129.07 g/mol
SMILES C1=CC=C(C=C1)[N+](=O)[O-]
InChIKey LQNUZADURLCDLV-IDEBNGHGSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is Nitro(~13~C_6_)benzene (CAS: 89059-37-0) typically synthesized?

Nitro(~13~C_6_)benzene (CAS: 89059-37-0) is typically synthesized by the nitration of toluene with c...

Compound Q&A

What industries use Nitro(~13~C_6_)benzene (CAS: 89059-37-0)?

Nitro(~13~C_6_)benzene (CAS: 89059-37-0) is used in various industries including pharmaceuticals, wh...

Compound Q&A

What precautions should be taken when handling Nitro(~13~C_6_)benzene (CAS: 89059-37-0)?

When handling Nitro(~13~C_6_)benze (CAS: 89059-37-0), it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...