Compound Q&A

How is Nitro(~13~C_6_)benzene (CAS: 89059-37-0) typically synthesized?

Answer

Nitro(~13~C_6_)benzene
Nitro(~13~C_6_)benzene (CAS: 89059-37-0) is typically synthesized by the nitration of toluene with concentrated nitric acid and sulfuric acid. The reaction is carried out under controlled conditions to achieve the desired yield and selectivity. Commonly, the reaction mixture is heated to around 50°C and the mixture is then washed and purified.

About

CAS No 89059-37-0
English Name Nitro(~13~C_6_)benzene
Molecular Formula 13C6H5NO2
Molecular Weight 129.07 g/mol
SMILES C1=CC=C(C=C1)[N+](=O)[O-]
InChIKey LQNUZADURLCDLV-IDEBNGHGSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Nitro(~13~C_6_)benzene (CAS: 89059-37-0)?

Nitro(~13~C_6_)benzene (CAS: 89059-37-0) is a crystalline compound with a molecular weight of approx...

Compound Q&A

What industries use Nitro(~13~C_6_)benzene (CAS: 89059-37-0)?

Nitro(~13~C_6_)benzene (CAS: 89059-37-0) is used in various industries including pharmaceuticals, wh...

Compound Q&A

What precautions should be taken when handling Nitro(~13~C_6_)benzene (CAS: 89059-37-0)?

When handling Nitro(~13~C_6_)benze (CAS: 89059-37-0), it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...