Compound Q&A

What industries use Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4)?

Answer

Chlorozinc(1+) (trimethylsilyl)ethynide
Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4) is utilized in various industries, particularly in the field of organic synthesis. It is a key reagent in the preparation of complex organic molecules, including pharmaceuticals, polymers, and sensors. The compound is also used in the development of new materials and semiconductor devices due to its unique chemical properties.

About

CAS No 78389-87-4
English Name Chlorozinc(1+) (trimethylsilyl)ethynide
Molecular Formula C5H9ClSiZn
Molecular Weight 88.23 g/mol
SMILES C[Si](C)(C)C#[C-].Cl[Zn+]
InChIKey ODBFHNBEIUVFJZ-UHFFFAOYSA-M
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4)?

Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4) is a crystalline compound with a molecular...

Compound Q&A

How is Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4) typically synthesized?

Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4) can be synthesized by reacting zinc with c...

Compound Q&A

What precautions should be taken when handling Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4)?

When handling Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4), appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...