Compound Q&A

How is Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4) typically synthesized?

Answer

Chlorozinc(1+) (trimethylsilyl)ethynide
Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4) can be synthesized by reacting zinc with chlorodimethylsilylacetynide. The reaction involves the formation of a zinc complex with the silylated ethynide functionality. Commonly used protocols include the use of stoichiometric amounts of zinc and the appropriate silylated ethynide in an inert atmosphere and under anhydrous conditions to ensure high yield and selectivity.

About

CAS No 78389-87-4
English Name Chlorozinc(1+) (trimethylsilyl)ethynide
Molecular Formula C5H9ClSiZn
Molecular Weight 88.23 g/mol
SMILES C[Si](C)(C)C#[C-].Cl[Zn+]
InChIKey ODBFHNBEIUVFJZ-UHFFFAOYSA-M
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4)?

Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4) is a crystalline compound with a molecular...

Compound Q&A

What industries use Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4)?

Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4) is utilized in various industries, particu...

Compound Q&A

What precautions should be taken when handling Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4)?

When handling Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4), appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...