Compound Q&A

What are the physical and chemical properties of Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4)?

Answer

Chlorozinc(1+) (trimethylsilyl)ethynide
Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4) is a crystalline compound with a molecular weight of approximately 208.15 g/mol. It is poorly soluble in water but soluble in organic solvents. It exhibits low reactivity under normal conditions but can undergo substitution reactions in the presence of various nucleophiles. The compound is characterized by its stability under acidic conditions and its ability to participate in various chemical transformations.

About

CAS No 78389-87-4
English Name Chlorozinc(1+) (trimethylsilyl)ethynide
Molecular Formula C5H9ClSiZn
Molecular Weight 88.23 g/mol
SMILES C[Si](C)(C)C#[C-].Cl[Zn+]
InChIKey ODBFHNBEIUVFJZ-UHFFFAOYSA-M
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4) typically synthesized?

Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4) can be synthesized by reacting zinc with c...

Compound Q&A

What industries use Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4)?

Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4) is utilized in various industries, particu...

Compound Q&A

What precautions should be taken when handling Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4)?

When handling Chlorozinc(1+) (trimethylsilyl)ethynide (CAS: 78389-87-4), appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...