Compound Q&A

What are the physical and chemical properties of 2-Bromo-4-(1-piperidinylmethyl)pyridine (CAS: 88046-02-0)?

Answer

2-Bromo-4-(1-piperidinylmethyl)pyridine
2-Bromo-4-(1-piperidinylmethyl)pyridine is a solid with a crystalline form. Its molecular weight is approximately 261.14 g/mol. This compound has limited water solubility but is more soluble in organic solvents like dimethylformamide (DMF) and acetonitrile. It is moderately reactive with strong nucleophiles and acidic conditions. The compound is stable under normal laboratory conditions but should be stored in a dry, cool place to prevent degradation.

About

CAS No 88046-02-0
English Name 2-Bromo-4-(1-piperidinylmethyl)pyridine
Molecular Formula C11H15BrN2
Molecular Weight 255.16 g/mol
SMILES C1CCN(CC1)CC2=CC(=NC=C2)Br
InChIKey ZTUBSWOWTOUXJJ-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is 2-Bromo-4-(1-piperidinylmethyl)pyridine (CAS: 88046-02-0) typically synthesized?

2-Bromo-4-(1-piperidinylmethyl)pyridine is typically synthesized through the reaction of 4-(1-piperi...

Compound Q&A

What industries use 2-Bromo-4-(1-piperidinylmethyl)pyridine (CAS: 88046-02-0)?

2-Bromo-4-(1-piperidinylmethyl)pyridine is used in pharmaceutical research for its potential as a pr...

Compound Q&A

What precautions should be taken when handling 2-Bromo-4-(1-piperidinylmethyl)pyridine (CAS: 88046-02-0)?

When handling 2-Bromo-4-(1-piperidinylmethyl)pyridine, users should wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...