Compound Q&A

What precautions should be taken when handling 2-Methoxy-4,5-dimethylbenzoic acid (CAS: 91061-36-8)?

Answer

2-Methoxy-4,5-dimethylbenzoic acid
Handling 2-Methoxy-4,5-dimethylbenzoic acid requires appropriate personal protective equipment (PPE). Wearing gloves, goggles, and a lab coat is essential to prevent skin and eye contact. The compound should be handled in a well-ventilated area or a fume hood due to its potential to release harmful fumes. In case of a spill, it should be cleaned up immediately with a suitable absorbent material, and the area should be well-ventilated. Refer to the Safety Data Sheet (SDS) for detailed information on proper handling and disposal. Storage should be in a cool, dry place, away from incompatible materials.

About

CAS No 91061-36-8
English Name 2-Methoxy-4,5-dimethylbenzoic acid
Molecular Formula C10H12O3
Molecular Weight 180.2 g/mol
SMILES CC1=CC(=C(C=C1C)OC)C(=O)O
InChIKey HATRJAVAPAPTBH-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methoxy-4,5-dimethylbenzoic acid (CAS: 91061-36-8)?

2-Methoxy-4,5-dimethylbenzoic acid is a solid compound with a crystalline form. Its molecular weight...

Compound Q&A

How is 2-Methoxy-4,5-dimethylbenzoic acid (CAS: 91061-36-8) typically synthesized?

2-Methoxy-4,5-dimethylbenzoic acid is typically synthesized through a multi-step process involving t...

Compound Q&A

What industries use 2-Methoxy-4,5-dimethylbenzoic acid (CAS: 91061-36-8)?

2-Methoxy-4,5-dimethylbenzoic acid has applications in various industries, particularly in the pharm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...