Compound Q&A

What industries use 2-Methoxy-4,5-dimethylbenzoic acid (CAS: 91061-36-8)?

Answer

2-Methoxy-4,5-dimethylbenzoic acid
2-Methoxy-4,5-dimethylbenzoic acid has applications in various industries, particularly in the pharmaceutical and chemical sectors. It is used as an intermediate in the synthesis of certain drugs and as a component in analytical chemistry for sensor applications. In the chemical industry, it is used in the production of dyes and pigments. Additionally, it may be used in the synthesis of organic semiconductors and as a reagent in polymer chemistry.

About

CAS No 91061-36-8
English Name 2-Methoxy-4,5-dimethylbenzoic acid
Molecular Formula C10H12O3
Molecular Weight 180.2 g/mol
SMILES CC1=CC(=C(C=C1C)OC)C(=O)O
InChIKey HATRJAVAPAPTBH-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methoxy-4,5-dimethylbenzoic acid (CAS: 91061-36-8)?

2-Methoxy-4,5-dimethylbenzoic acid is a solid compound with a crystalline form. Its molecular weight...

Compound Q&A

How is 2-Methoxy-4,5-dimethylbenzoic acid (CAS: 91061-36-8) typically synthesized?

2-Methoxy-4,5-dimethylbenzoic acid is typically synthesized through a multi-step process involving t...

Compound Q&A

What precautions should be taken when handling 2-Methoxy-4,5-dimethylbenzoic acid (CAS: 91061-36-8)?

Handling 2-Methoxy-4,5-dimethylbenzoic acid requires appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...