Compound Q&A

How is 2-Methoxy-4,5-dimethylbenzoic acid (CAS: 91061-36-8) typically synthesized?

Answer

2-Methoxy-4,5-dimethylbenzoic acid
2-Methoxy-4,5-dimethylbenzoic acid is typically synthesized through a multi-step process involving the methylation of benzene followed by esterification. The initial step involves the bromination of toluene to form 4-bromotoluene, which is then methylated using methyl iodide and sodium hydride. The resulting 4-methylbenzyl bromide undergoes an esterification reaction with methanol and acetic anhydride to produce the final product. The reaction is catalyzed by sulfuric acid, and the overall process yields approximately 85% of the desired compound.

About

CAS No 91061-36-8
English Name 2-Methoxy-4,5-dimethylbenzoic acid
Molecular Formula C10H12O3
Molecular Weight 180.2 g/mol
SMILES CC1=CC(=C(C=C1C)OC)C(=O)O
InChIKey HATRJAVAPAPTBH-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methoxy-4,5-dimethylbenzoic acid (CAS: 91061-36-8)?

2-Methoxy-4,5-dimethylbenzoic acid is a solid compound with a crystalline form. Its molecular weight...

Compound Q&A

What industries use 2-Methoxy-4,5-dimethylbenzoic acid (CAS: 91061-36-8)?

2-Methoxy-4,5-dimethylbenzoic acid has applications in various industries, particularly in the pharm...

Compound Q&A

What precautions should be taken when handling 2-Methoxy-4,5-dimethylbenzoic acid (CAS: 91061-36-8)?

Handling 2-Methoxy-4,5-dimethylbenzoic acid requires appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...