Compound Q&A

What are the physical and chemical properties of (R)-2-(3-Fluorophenyl)pyrrolidine L-tartrate (CAS: 1391463-17-4)?

Answer

(R)-2-(3-Fluorophenyl)pyrrolidine L-tartrate
(R)-2-(3-Fluorophenyl)pyrrolidine L-tartrate is a crystalline compound with a molecular weight of approximately 302.23 g/mol. It has a melting point of about 160-162°C and is sparingly soluble in water. The compound is known for its moderate reactivity, particularly towards nucleophiles. It can form complexes with various metals and is often used in pharmaceutical applications due to its structural stability.

About

English Name (R)-2-(3-Fluorophenyl)pyrrolidine L-tartrate
Molecular Formula C14H18FNO6
Molecular Weight 315.3 g/mol
SMILES C1CC(NC1)C2=CC(=CC=C2)F.C(C(C(=O)O)O)(C(=O)O)O
InChIKey LPQAIJHTOIUGNX-PRCBPEIBSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is (R)-2-(3-Fluorophenyl)pyrrolidine L-tartrate (CAS: 1391463-17-4) typically synthesized?

(R)-2-(3-Fluorophenyl)pyrrolidine L-tartrate is commonly synthesized via a multistep process involvi...

Compound Q&A

What industries use (R)-2-(3-Fluorophenyl)pyrrolidine L-tartrate (CAS: 1391463-17-4)?

(R)-2-(3-Fluorophenyl)pyrrolidine L-tartrate finds application in the pharmaceutical and fine chemic...

Compound Q&A

What precautions should be taken when handling (R)-2-(3-Fluorophenyl)pyrrolidine L-tartrate (CAS: 1391463-17-4)?

When handling (R)-2-(3-Fluorophenyl)pyrrolidine L-tartrate, it is important to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...