Compound Q&A

What precautions should be taken when handling Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8)?

Answer

Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate
When handling Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Ensure the use of a fume hood during operations to minimize inhalation risk. Spills should be cleaned up using appropriate absorbent materials, and the area should be ventilated. Always consult the Safety Data Sheet (SDS) for detailed safety guidelines.

About

CAS No 68471-57-8
English Name Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate
Molecular Formula C12H13NO2
Molecular Weight 203.24 g/mol
SMILES C1CN(C=C1)C(=O)OCC2=CC=CC=C2
InChIKey ZNLOEFQSAKKFGT-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8)?

Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8) is a white crystalline solid with a mo...

Compound Q&A

How is Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8) typically synthesized?

Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8) can be synthesized via a multistep pro...

Compound Q&A

What industries use Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8)?

Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8) finds applications in the pharmaceutic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...