Compound Q&A

How is Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8) typically synthesized?

Answer

Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate
Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8) can be synthesized via a multistep process involving the formation of a pyrrole followed by its coupling with benzyl chloride. The synthesis typically involves the use of acetic anhydride and catalysis by a strong base like sodium hydride. The overall yield is around 70-80%, and the process is selective and highly reproducible.

About

CAS No 68471-57-8
English Name Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate
Molecular Formula C12H13NO2
Molecular Weight 203.24 g/mol
SMILES C1CN(C=C1)C(=O)OCC2=CC=CC=C2
InChIKey ZNLOEFQSAKKFGT-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8)?

Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8) is a white crystalline solid with a mo...

Compound Q&A

What industries use Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8)?

Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8) finds applications in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8)?

When handling Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...