Compound Q&A

What industries use Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8)?

Answer

Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate
Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8) finds applications in the pharmaceutical industry for the synthesis of various drug intermediates. It is also used in the polymer industry for the modification of polymer properties and in the semiconductor industry for the production of functional materials.

About

CAS No 68471-57-8
English Name Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate
Molecular Formula C12H13NO2
Molecular Weight 203.24 g/mol
SMILES C1CN(C=C1)C(=O)OCC2=CC=CC=C2
InChIKey ZNLOEFQSAKKFGT-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8)?

Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8) is a white crystalline solid with a mo...

Compound Q&A

How is Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8) typically synthesized?

Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8) can be synthesized via a multistep pro...

Compound Q&A

What precautions should be taken when handling Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8)?

When handling Benzyl 2,3-dihydro-1H-pyrrole-1-carboxylate (CAS: 68471-57-8), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...