Compound Q&A

What industries use Ophiobolin B (CAS: 5601-74-1)?

Answer

Ophiobolin B
Ophiobolin B (CAS: 5601-74-1) is primarily used in the pharmaceutical industry for its potential as a bioactive compound. It has also shown promise in the development of new materials and sensors due to its unique chemical properties. Its use in semiconductors and polymers is still under research but shows potential for future applications.

About

CAS No 5601-74-1
English Name Ophiobolin B
Molecular Formula C25H38O4
Molecular Weight 402.57500000000016 g/mol
SMILES CC(CCC=C(C)C)C1(CCC2(C1CC=C(C3C(C2)C(CC3=O)(C)O)C=O)C)O
InChIKey SXRLPRKYTRWOES-PCQMDVLKSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ophiobolin B (CAS: 5601-74-1)?

Ophiobolin B (CAS: 5601-74-1) is a cyclic diterpene with a molecular weight of approximately 470.33 ...

Compound Q&A

How is Ophiobolin B (CAS: 5601-74-1) typically synthesized?

Ophiobolin B (CAS: 5601-74-1) is synthesized through a semi-synthetic route from naturally occurring...

Compound Q&A

What precautions should be taken when handling Ophiobolin B (CAS: 5601-74-1)?

When handling Ophiobolin B (CAS: 5601-74-1), wear appropriate personal protective equipment (PPE) in...

Compound Q&A

What precautions should be taken when handling 4-(2-Furylmethyl)thiomorpholine 1,1-dioxide (CAS: 79206-94-3)?

When handling 4-(2-Furylmethyl)thiomorpholine 1,1-dioxide (CAS: 79206-94-3), it ...

79206-94-34-(2-Furylmethyl)thi...
Compound Q&A

What precautions should be taken when handling 4-Chloro-N-[2-(4-morpholinyl)ethyl]benzamide (CAS: 71320-77-9)?

When handling 4-Chloro-N-[2-(4-morpholinyl)ethyl]benzamide (CAS: 71320-77-9), it...

71320-77-94-Chloro-N-[2-(4-mor...
Compound Q&A

How should waste containing 2-[2-(2-Methoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate (CAS: 62921-74-8) be handled?

Waste containing this compound (CAS: 62921-74-8) should be handled according to ...

62921-74-82-[2-(2-Methoxyethox...
Compound Q&A

How should waste containing (S)-Methyl 2-amino-3-cyclohexylpropanoate be handled?

Waste containing (S)-Methyl 2-amino-3-cyclohexylpropanoate should be collected i...

40056-18-6(S)-Methyl 2-amino-3...