Compound Q&A

What are the physical and chemical properties of Ophiobolin B (CAS: 5601-74-1)?

Answer

Ophiobolin B
Ophiobolin B (CAS: 5601-74-1) is a cyclic diterpene with a molecular weight of approximately 470.33 g/mol. It is generally insoluble in water but soluble in organic solvents such as ethanol and acetone. Chemically, it is relatively stable but can react with strong oxidizing agents. Its crystalline form has a melting point around 150°C.

About

CAS No 5601-74-1
English Name Ophiobolin B
Molecular Formula C25H38O4
Molecular Weight 402.57500000000016 g/mol
SMILES CC(CCC=C(C)C)C1(CCC2(C1CC=C(C3C(C2)C(CC3=O)(C)O)C=O)C)O
InChIKey SXRLPRKYTRWOES-PCQMDVLKSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is Ophiobolin B (CAS: 5601-74-1) typically synthesized?

Ophiobolin B (CAS: 5601-74-1) is synthesized through a semi-synthetic route from naturally occurring...

Compound Q&A

What industries use Ophiobolin B (CAS: 5601-74-1)?

Ophiobolin B (CAS: 5601-74-1) is primarily used in the pharmaceutical industry for its potential as ...

Compound Q&A

What precautions should be taken when handling Ophiobolin B (CAS: 5601-74-1)?

When handling Ophiobolin B (CAS: 5601-74-1), wear appropriate personal protective equipment (PPE) in...

Compound Q&A

What precautions should be taken when handling 4-(2-Furylmethyl)thiomorpholine 1,1-dioxide (CAS: 79206-94-3)?

When handling 4-(2-Furylmethyl)thiomorpholine 1,1-dioxide (CAS: 79206-94-3), it ...

79206-94-34-(2-Furylmethyl)thi...
Compound Q&A

What precautions should be taken when handling 4-Chloro-N-[2-(4-morpholinyl)ethyl]benzamide (CAS: 71320-77-9)?

When handling 4-Chloro-N-[2-(4-morpholinyl)ethyl]benzamide (CAS: 71320-77-9), it...

71320-77-94-Chloro-N-[2-(4-mor...
Compound Q&A

How should waste containing 2-[2-(2-Methoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate (CAS: 62921-74-8) be handled?

Waste containing this compound (CAS: 62921-74-8) should be handled according to ...

62921-74-82-[2-(2-Methoxyethox...
Compound Q&A

How should waste containing (S)-Methyl 2-amino-3-cyclohexylpropanoate be handled?

Waste containing (S)-Methyl 2-amino-3-cyclohexylpropanoate should be collected i...

40056-18-6(S)-Methyl 2-amino-3...