Compound Q&A

What are the physical and chemical properties of Ophiobolin B (CAS: 5601-74-1)?

Answer

Ophiobolin B
Ophiobolin B (CAS: 5601-74-1) is a cyclic diterpene with a molecular weight of approximately 470.33 g/mol. It is generally insoluble in water but soluble in organic solvents such as ethanol and acetone. Chemically, it is relatively stable but can react with strong oxidizing agents. Its crystalline form has a melting point around 150°C.

About

CAS No 5601-74-1
English Name Ophiobolin B
Molecular Formula C25H38O4
Molecular Weight 402.58 g/mol
SMILES CC(CCC=C(C)C)C1(CCC2(C1CC=C(C3C(C2)C(CC3=O)(C)O)C=O)C)O
InChIKey SXRLPRKYTRWOES-PCQMDVLKSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is Ophiobolin B (CAS: 5601-74-1) typically synthesized?

Ophiobolin B (CAS: 5601-74-1) is synthesized through a semi-synthetic route from naturally occurring...

Compound Q&A

What industries use Ophiobolin B (CAS: 5601-74-1)?

Ophiobolin B (CAS: 5601-74-1) is primarily used in the pharmaceutical industry for its potential as ...

Compound Q&A

What precautions should be taken when handling Ophiobolin B (CAS: 5601-74-1)?

When handling Ophiobolin B (CAS: 5601-74-1), wear appropriate personal protective equipment (PPE) in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...