Compound Q&A

How is Ophiobolin B (CAS: 5601-74-1) typically synthesized?

Answer

Ophiobolin B
Ophiobolin B (CAS: 5601-74-1) is synthesized through a semi-synthetic route from naturally occurring compounds. Common methods involve biotransformation using microbial cultures followed by chemical modifications. Catalysts such as enzymes and metal complexes are used to achieve high selectivity and yield in the synthesis process.

About

CAS No 5601-74-1
English Name Ophiobolin B
Molecular Formula C25H38O4
Molecular Weight 402.57500000000016 g/mol
SMILES CC(CCC=C(C)C)C1(CCC2(C1CC=C(C3C(C2)C(CC3=O)(C)O)C=O)C)O
InChIKey SXRLPRKYTRWOES-PCQMDVLKSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ophiobolin B (CAS: 5601-74-1)?

Ophiobolin B (CAS: 5601-74-1) is a cyclic diterpene with a molecular weight of approximately 470.33 ...

Compound Q&A

What industries use Ophiobolin B (CAS: 5601-74-1)?

Ophiobolin B (CAS: 5601-74-1) is primarily used in the pharmaceutical industry for its potential as ...

Compound Q&A

What precautions should be taken when handling Ophiobolin B (CAS: 5601-74-1)?

When handling Ophiobolin B (CAS: 5601-74-1), wear appropriate personal protective equipment (PPE) in...

Compound Q&A

What precautions should be taken when handling 4-(2-Furylmethyl)thiomorpholine 1,1-dioxide (CAS: 79206-94-3)?

When handling 4-(2-Furylmethyl)thiomorpholine 1,1-dioxide (CAS: 79206-94-3), it ...

79206-94-34-(2-Furylmethyl)thi...
Compound Q&A

What precautions should be taken when handling 4-Chloro-N-[2-(4-morpholinyl)ethyl]benzamide (CAS: 71320-77-9)?

When handling 4-Chloro-N-[2-(4-morpholinyl)ethyl]benzamide (CAS: 71320-77-9), it...

71320-77-94-Chloro-N-[2-(4-mor...
Compound Q&A

How should waste containing 2-[2-(2-Methoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate (CAS: 62921-74-8) be handled?

Waste containing this compound (CAS: 62921-74-8) should be handled according to ...

62921-74-82-[2-(2-Methoxyethox...
Compound Q&A

How should waste containing (S)-Methyl 2-amino-3-cyclohexylpropanoate be handled?

Waste containing (S)-Methyl 2-amino-3-cyclohexylpropanoate should be collected i...

40056-18-6(S)-Methyl 2-amino-3...