Compound Q&A

What precautions should be taken when handling 5a,6,7,8,8a,9-Hexahydro-5H-chromeno[3,2-d]xanthene-1,13-diylbis[bis(3,5-dimethylphenyl)phosphine] (CAS: 1429939-35-4)?

Answer

5a,6,7,8,8a,9-Hexahydro-5H-chromeno[3,2-d]xanthene-1,13-diylbis[bis(3,5-dimethylphenyl)phosphine]
When handling this compound, it is essential to use appropriate personal protective equipment (PPE), including gloves and safety goggles. Ensure that all operations are conducted in a well-ventilated area or fume hood. Spills should be cleaned up immediately using appropriate absorbent materials. Always consult the Safety Data Sheet (SDS) for detailed safety instructions and emergency procedures.

About

English Name 5a,6,7,8,8a,9-Hexahydro-5H-chromeno[3,2-d]xanthene-1,13-diylbis[bis(3,5-dimethylphenyl)phosphine]
Molecular Formula C52H54O2P2
Molecular Weight 772.95 g/mol
SMILES Cc1cc(cc(c1)P(c2cccc3c2OC45C(C3)CCCC4Cc6cccc(c6O5)P(c7cc(cc(c7)C)C)c8cc(cc(c8)C)C)c9cc(cc(c9)C)C)C
InChIKey IYNVDHXMWJJRHM-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5a,6,7,8,8a,9-Hexahydro-5H-chromeno[3,2-d]xanthene-1,13-diylbis[bis(3,5-dimethylphenyl)phosphine] (CAS: 1429939-35-4)?

The compound is a solid with a crystalline form. Its molecular weight is approximately 760.51 g/mol....

Compound Q&A

How is 5a,6,7,8,8a,9-Hexahydro-5H-chromeno[3,2-d]xanthene-1,13-diylbis[bis(3,5-dimethylphenyl)phosphine] (CAS: 1429939-35-4) typically synthesized?

The compound is typically synthesized through a multistep process involving the condensation of appr...

Compound Q&A

What industries use 5a,6,7,8,8a,9-Hexahydro-5H-chromeno[3,2-d]xanthene-1,13-diylbis[bis(3,5-dimethylphenyl)phosphine] (CAS: 1429939-35-4)?

This compound finds applications in the pharmaceutical industry for its potential as a pharmacologic...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...