Compound Q&A

How is 5a,6,7,8,8a,9-Hexahydro-5H-chromeno[3,2-d]xanthene-1,13-diylbis[bis(3,5-dimethylphenyl)phosphine] (CAS: 1429939-35-4) typically synthesized?

Answer

5a,6,7,8,8a,9-Hexahydro-5H-chromeno[3,2-d]xanthene-1,13-diylbis[bis(3,5-dimethylphenyl)phosphine]
The compound is typically synthesized through a multistep process involving the condensation of appropriate chromene and phosphine derivatives. Commonly, the synthesis involves the use of Lewis acids as catalysts to promote the coupling reaction. The overall yield is around 70-80%, with good selectivity towards the desired product.

About

English Name 5a,6,7,8,8a,9-Hexahydro-5H-chromeno[3,2-d]xanthene-1,13-diylbis[bis(3,5-dimethylphenyl)phosphine]
Molecular Formula C52H54O2P2
Molecular Weight 772.95 g/mol
SMILES Cc1cc(cc(c1)P(c2cccc3c2OC45C(C3)CCCC4Cc6cccc(c6O5)P(c7cc(cc(c7)C)C)c8cc(cc(c8)C)C)c9cc(cc(c9)C)C)C
InChIKey IYNVDHXMWJJRHM-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5a,6,7,8,8a,9-Hexahydro-5H-chromeno[3,2-d]xanthene-1,13-diylbis[bis(3,5-dimethylphenyl)phosphine] (CAS: 1429939-35-4)?

The compound is a solid with a crystalline form. Its molecular weight is approximately 760.51 g/mol....

Compound Q&A

What industries use 5a,6,7,8,8a,9-Hexahydro-5H-chromeno[3,2-d]xanthene-1,13-diylbis[bis(3,5-dimethylphenyl)phosphine] (CAS: 1429939-35-4)?

This compound finds applications in the pharmaceutical industry for its potential as a pharmacologic...

Compound Q&A

What precautions should be taken when handling 5a,6,7,8,8a,9-Hexahydro-5H-chromeno[3,2-d]xanthene-1,13-diylbis[bis(3,5-dimethylphenyl)phosphine] (CAS: 1429939-35-4)?

When handling this compound, it is essential to use appropriate personal protective equipment (PPE),...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...