Compound Q&A

What are the physical and chemical properties of 5a,6,7,8,8a,9-Hexahydro-5H-chromeno[3,2-d]xanthene-1,13-diylbis[bis(3,5-dimethylphenyl)phosphine] (CAS: 1429939-35-4)?

Answer

5a,6,7,8,8a,9-Hexahydro-5H-chromeno[3,2-d]xanthene-1,13-diylbis[bis(3,5-dimethylphenyl)phosphine]
The compound is a solid with a crystalline form. Its molecular weight is approximately 760.51 g/mol. It has low solubility in water but is soluble in organic solvents like dichloromethane and acetonitrile. The compound is known for its stability under normal conditions and moderate reactivity towards nucleophiles.

About

English Name 5a,6,7,8,8a,9-Hexahydro-5H-chromeno[3,2-d]xanthene-1,13-diylbis[bis(3,5-dimethylphenyl)phosphine]
Molecular Formula C52H54O2P2
Molecular Weight 772.95 g/mol
SMILES Cc1cc(cc(c1)P(c2cccc3c2OC45C(C3)CCCC4Cc6cccc(c6O5)P(c7cc(cc(c7)C)C)c8cc(cc(c8)C)C)c9cc(cc(c9)C)C)C
InChIKey IYNVDHXMWJJRHM-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is 5a,6,7,8,8a,9-Hexahydro-5H-chromeno[3,2-d]xanthene-1,13-diylbis[bis(3,5-dimethylphenyl)phosphine] (CAS: 1429939-35-4) typically synthesized?

The compound is typically synthesized through a multistep process involving the condensation of appr...

Compound Q&A

What industries use 5a,6,7,8,8a,9-Hexahydro-5H-chromeno[3,2-d]xanthene-1,13-diylbis[bis(3,5-dimethylphenyl)phosphine] (CAS: 1429939-35-4)?

This compound finds applications in the pharmaceutical industry for its potential as a pharmacologic...

Compound Q&A

What precautions should be taken when handling 5a,6,7,8,8a,9-Hexahydro-5H-chromeno[3,2-d]xanthene-1,13-diylbis[bis(3,5-dimethylphenyl)phosphine] (CAS: 1429939-35-4)?

When handling this compound, it is essential to use appropriate personal protective equipment (PPE),...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...