Compound Q&A

What industries use Ethyl 5-iodo-2-methylbenzoate (CAS: 612833-45-1)?

Answer

Ethyl 5-iodo-2-methylbenzoate
Ethyl 5-iodo-2-methylbenzoate (CAS: 612833-45-1) is primarily used in the pharmaceutical industry for the synthesis of certain drugs, as a precursor in organic synthesis, and in the chemical industry for the production of various compounds. It is also utilized in the polymer industry as a stabilizer and in the semiconductor industry for photoresist applications.

About

English Name Ethyl 5-iodo-2-methylbenzoate
Molecular Formula C10H11IO2
Molecular Weight 290.1 g/mol
SMILES CCOC(=O)C1=C(C=CC(=C1)I)C
InChIKey KIXOYKIVPNXTDY-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 5-iodo-2-methylbenzoate (CAS: 612833-45-1)?

Ethyl 5-iodo-2-methylbenzoate (CAS: 612833-45-1) has a crystalline form and a molecular weight of ap...

Compound Q&A

How is Ethyl 5-iodo-2-methylbenzoate (CAS: 612833-45-1) typically synthesized?

Ethyl 5-iodo-2-methylbenzoate (CAS: 612833-45-1) can be synthesized through the Williamson ether syn...

Compound Q&A

What precautions should be taken when handling Ethyl 5-iodo-2-methylbenzoate (CAS: 612833-45-1)?

When handling Ethyl 5-iodo-2-methylbenzoate (CAS: 612833-45-1), wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...