Compound Q&A

What are the physical and chemical properties of Ethyl 5-iodo-2-methylbenzoate (CAS: 612833-45-1)?

Answer

Ethyl 5-iodo-2-methylbenzoate
Ethyl 5-iodo-2-methylbenzoate (CAS: 612833-45-1) has a crystalline form and a molecular weight of approximately 328.05 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. The compound is moderately reactive and can undergo nucleophilic substitution reactions due to the presence of the iodine atom.

About

English Name Ethyl 5-iodo-2-methylbenzoate
Molecular Formula C10H11IO2
Molecular Weight 290.1 g/mol
SMILES CCOC(=O)C1=C(C=CC(=C1)I)C
InChIKey KIXOYKIVPNXTDY-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is Ethyl 5-iodo-2-methylbenzoate (CAS: 612833-45-1) typically synthesized?

Ethyl 5-iodo-2-methylbenzoate (CAS: 612833-45-1) can be synthesized through the Williamson ether syn...

Compound Q&A

What industries use Ethyl 5-iodo-2-methylbenzoate (CAS: 612833-45-1)?

Ethyl 5-iodo-2-methylbenzoate (CAS: 612833-45-1) is primarily used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling Ethyl 5-iodo-2-methylbenzoate (CAS: 612833-45-1)?

When handling Ethyl 5-iodo-2-methylbenzoate (CAS: 612833-45-1), wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...