Compound Q&A

What precautions should be taken when handling 2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate (CAS: 873055-54-0)?

Answer

2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate
When handling 2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate, it is important to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. It should be stored in a closed container under a nitrogen atmosphere to prevent decomposition. In the event of a spill, it should be cleaned up with appropriate disposal methods as per the Material Safety Data Sheet (SDS). Handling should be done in a well-ventilated area or a fume hood to avoid inhalation of fumes.

About

English Name 2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate
Molecular Formula C16H24O3
Molecular Weight 264.36 g/mol
SMILES CC(C)(C)c1ccc(c(c1)C(C)(C)C)OC(=O)OC
InChIKey MRZZXDUZVJNFQL-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate (CAS: 873055-54-0)?

2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate is a colorless to pale yellow liquid with a mole...

Compound Q&A

How is 2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate (CAS: 873055-54-0) typically synthesized?

2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate is typically synthesized through the reaction of...

Compound Q&A

What industries use 2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate (CAS: 873055-54-0)?

2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate is used in the pharmaceutical industry for the s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...