Compound Q&A

What industries use 2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate (CAS: 873055-54-0)?

Answer

2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate
2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate is used in the pharmaceutical industry for the synthesis of certain drug intermediates. It also finds applications in polymer chemistry for modifying the properties of polymers and in the production of sensors due to its reactivity. Additionally, it can be used in the electronics industry for semiconductor applications.

About

English Name 2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate
Molecular Formula C16H24O3
Molecular Weight 264.36 g/mol
SMILES CC(C)(C)c1ccc(c(c1)C(C)(C)C)OC(=O)OC
InChIKey MRZZXDUZVJNFQL-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate (CAS: 873055-54-0)?

2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate is a colorless to pale yellow liquid with a mole...

Compound Q&A

How is 2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate (CAS: 873055-54-0) typically synthesized?

2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate is typically synthesized through the reaction of...

Compound Q&A

What precautions should be taken when handling 2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate (CAS: 873055-54-0)?

When handling 2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate, it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...