Compound Q&A

How is 2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate (CAS: 873055-54-0) typically synthesized?

Answer

2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate
2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate is typically synthesized through the reaction of phenol derivatives with methyl carbonate, catalyzed by a base like potassium carbonate. The reaction is carried out under mild conditions, and the product is isolated by distillation. The yield is generally high, and the method is known for its good selectivity.

About

English Name 2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate
Molecular Formula C16H24O3
Molecular Weight 264.36 g/mol
SMILES CC(C)(C)c1ccc(c(c1)C(C)(C)C)OC(=O)OC
InChIKey MRZZXDUZVJNFQL-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate (CAS: 873055-54-0)?

2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate is a colorless to pale yellow liquid with a mole...

Compound Q&A

What industries use 2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate (CAS: 873055-54-0)?

2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate is used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling 2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate (CAS: 873055-54-0)?

When handling 2,4-Bis(2-methyl-2-propanyl)phenyl methyl carbonate, it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...