Compound Q&A

How is ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate (CAS: 885271-93-2) typically synthesized?

Answer

ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate
Ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate (CAS: 885271-93-2) is typically synthesized via a multistep process involving the condensation of 5-fluoro-1H-indazole with acetyl chloride followed by an esterification reaction with ethanol. Commonly used catalysts include acid catalysts like hydrochloric acid. The synthetic route provides high selectivity and good yield of the desired product.

About

English Name ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate
Molecular Formula C11H11FN2O2
Molecular Weight 222.22 g/mol
SMILES CCOC(=O)CC1=C2C=C(C=CC2=NN1)F
InChIKey RLQKHYIJSNFESC-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate (CAS: 885271-93-2)?

Ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate (CAS: 885271-93-2) is a crystalline solid with a molecular...

Compound Q&A

What industries use ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate (CAS: 885271-93-2)?

Ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate (CAS: 885271-93-2) is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate (CAS: 885271-93-2)?

When handling ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate (CAS: 885271-93-2), appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...