Compound Q&A

What are the physical and chemical properties of ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate (CAS: 885271-93-2)?

Answer

ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate
Ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate (CAS: 885271-93-2) is a crystalline solid with a molecular weight of approximately 241.24 g/mol. It is slightly soluble in water and more soluble in common organic solvents like ethanol and dichloromethane. The compound shows moderate reactivity due to its functional groups, particularly the acetate ester and the indazole ring. It can undergo hydrolysis and nucleophilic substitution reactions under appropriate conditions.

About

English Name ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate
Molecular Formula C11H11FN2O2
Molecular Weight 222.22 g/mol
SMILES CCOC(=O)CC1=C2C=C(C=CC2=NN1)F
InChIKey RLQKHYIJSNFESC-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate (CAS: 885271-93-2) typically synthesized?

Ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate (CAS: 885271-93-2) is typically synthesized via a multiste...

Compound Q&A

What industries use ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate (CAS: 885271-93-2)?

Ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate (CAS: 885271-93-2) is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate (CAS: 885271-93-2)?

When handling ethyl 2-(5-fluoro-1H-indazol-3-yl)acetate (CAS: 885271-93-2), appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...