Compound Q&A

What industries use 4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4)?

Answer

4-Butoxyphenyl 4-hydroxybenzoate
4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also utilized in the cosmetic industry for its antioxidant properties and in the polymer industry as a stabilizer. Additionally, it can be found in the sensor and semiconductor industries for specialized applications.

About

CAS No 70568-44-4
English Name 4-Butoxyphenyl 4-hydroxybenzoate
Molecular Formula C17H18O4
Molecular Weight 286.33 g/mol
SMILES CCCCOC1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)O
InChIKey NMPRZRJMGXDQJH-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4)?

4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4) is a white crystalline solid with a molecular wei...

Compound Q&A

How is 4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4) typically synthesized?

4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4) can be synthesized via a two-step process. First,...

Compound Q&A

What precautions should be taken when handling 4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4)?

When handling 4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4), it is crucial to use appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...