Compound Q&A

What are the physical and chemical properties of 4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4)?

Answer

4-Butoxyphenyl 4-hydroxybenzoate
4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4) is a white crystalline solid with a molecular weight of approximately 246.25 g/mol. It has a low solubility in water but is readily soluble in organic solvents such as ethanol and acetone. Chemically, it is stable under normal conditions but can react with strong acids or bases to form other products. It does not typically exhibit significant reactivity under normal laboratory conditions.

About

CAS No 70568-44-4
English Name 4-Butoxyphenyl 4-hydroxybenzoate
Molecular Formula C17H18O4
Molecular Weight 286.33 g/mol
SMILES CCCCOC1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)O
InChIKey NMPRZRJMGXDQJH-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is 4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4) typically synthesized?

4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4) can be synthesized via a two-step process. First,...

Compound Q&A

What industries use 4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4)?

4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4) is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4)?

When handling 4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4), it is crucial to use appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...