Compound Q&A

How is 4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4) typically synthesized?

Answer

4-Butoxyphenyl 4-hydroxybenzoate
4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4) can be synthesized via a two-step process. First, butoxybenzoic acid is converted to the corresponding ester using a standard esterification protocol. This process typically involves the use of a strong acid catalyst like concentrated sulfuric acid. Second, the product is then reacted with 4-hydroxybenzoic acid in the presence of a suitable base, such as sodium hydroxide, to form the final compound.

About

CAS No 70568-44-4
English Name 4-Butoxyphenyl 4-hydroxybenzoate
Molecular Formula C17H18O4
Molecular Weight 286.33 g/mol
SMILES CCCCOC1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)O
InChIKey NMPRZRJMGXDQJH-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4)?

4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4) is a white crystalline solid with a molecular wei...

Compound Q&A

What industries use 4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4)?

4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4) is primarily used in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling 4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4)?

When handling 4-Butoxyphenyl 4-hydroxybenzoate (CAS: 70568-44-4), it is crucial to use appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...