Compound Q&A

What precautions should be taken when handling Atracurium Impurity 5 HCl (CAS: 2048273-58-9)?

Answer

Atracurium Impurity 5 HCl
When handling Atracurium Impurity 5 HCl, it is essential to use personal protective equipment (PPE) including gloves, safety goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up carefully, and proper storage in a cool, dry place away from heat sources is recommended. Safety data sheets (SDS) should be consulted for detailed handling and storage guidelines.

About

English Name Atracurium Impurity 5 HCl
Molecular Formula C22H30ClNO5
Molecular Weight 423.93700000000007 g/mol
SMILES COC1=C(OC)C(OC)=CC(CC2N(C)CCC3=C2C=C(OC)C(OC)=C3)=C1.[H]Cl
InChIKey MJNFVFFEXXQRMF-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Atracurium Impurity 5 HCl (CAS: 2048273-58-9)?

Atracurium Impurity 5 HCl is a crystalline compound with a molecular weight of approximately 494.6 g...

Compound Q&A

How is Atracurium Impurity 5 HCl (CAS: 2048273-58-9) typically synthesized?

Atracurium Impurity 5 HCl is typically synthesized as a byproduct during the production of atracuriu...

Compound Q&A

What industries use Atracurium Impurity 5 HCl (CAS: 2048273-58-9)?

Atracurium Impurity 5 HCl is primarily used in the pharmaceutical industry to ensure the purity and ...

Compound Q&A

How should waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) be handled?

Waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) ...

265652-39-94-Bromo-3-methyl-2-t...
Compound Q&A

What industries use (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) (CAS: 136779-26-5)?

(2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) is primarily u...

136779-26-5(2S,5S,2'S,5'S)-1,1'...
Compound Q&A

What industries use Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is used in the pharm...

1214910-61-8Ethyl 2-(2-bromo-5-f...
Compound Q&A

How is 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) typically synthesized?

4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) can be synthesized through seve...

4792-30-74-Methyl-2-benzofura...