Compound Q&A

How is Atracurium Impurity 5 HCl (CAS: 2048273-58-9) typically synthesized?

Answer

Atracurium Impurity 5 HCl
Atracurium Impurity 5 HCl is typically synthesized as a byproduct during the production of atracurium. The synthesis involves multi-step organic reactions, including nucleophilic substitution and condensation, with careful control over reaction conditions to maintain high selectivity and yield. Specific catalysts and reagents are used to minimize side products like Atracurium Impurity 5 HCl.

About

English Name Atracurium Impurity 5 HCl
Molecular Formula C22H30ClNO5
Molecular Weight 423.93700000000007 g/mol
SMILES COC1=C(OC)C(OC)=CC(CC2N(C)CCC3=C2C=C(OC)C(OC)=C3)=C1.[H]Cl
InChIKey MJNFVFFEXXQRMF-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Atracurium Impurity 5 HCl (CAS: 2048273-58-9)?

Atracurium Impurity 5 HCl is a crystalline compound with a molecular weight of approximately 494.6 g...

Compound Q&A

What industries use Atracurium Impurity 5 HCl (CAS: 2048273-58-9)?

Atracurium Impurity 5 HCl is primarily used in the pharmaceutical industry to ensure the purity and ...

Compound Q&A

What precautions should be taken when handling Atracurium Impurity 5 HCl (CAS: 2048273-58-9)?

When handling Atracurium Impurity 5 HCl, it is essential to use personal protective equipment (PPE) ...

Compound Q&A

How should waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) be handled?

Waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) ...

265652-39-94-Bromo-3-methyl-2-t...
Compound Q&A

What industries use (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) (CAS: 136779-26-5)?

(2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) is primarily u...

136779-26-5(2S,5S,2'S,5'S)-1,1'...
Compound Q&A

What industries use Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is used in the pharm...

1214910-61-8Ethyl 2-(2-bromo-5-f...
Compound Q&A

How is 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) typically synthesized?

4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) can be synthesized through seve...

4792-30-74-Methyl-2-benzofura...