Compound Q&A

What industries use 2-Hydroxy-1,4-dimethyl-6-oxo-5-{(E)-[3-(phenylsulfonyl)phenyl]diazenyl}-1,6-dihydro-3-pyridinecarbonitrile (CAS: 61968-66-9)?

Answer

2-Hydroxy-1,4-dimethyl-6-oxo-5-{(E)-[3-(phenylsulfonyl)phenyl]diazenyl}-1,6-dihydro-3-pyridinecarbonitrile
This compound is primarily used in the pharmaceutical industry for the synthesis of complex molecules and in sensor technology for detecting specific analytes. It also finds applications in the production of polymers and semiconductors due to its unique chemical structure and reactivity. Its ability to form stable complexes with metal ions makes it valuable in catalytic processes and as a ligand in coordination chemistry.

About

CAS No 61968-66-9
English Name 2-Hydroxy-1,4-dimethyl-6-oxo-5-{(E)-[3-(phenylsulfonyl)phenyl]diazenyl}-1,6-dihydro-3-pyridinecarbonitrile
Molecular Formula C20H16N4O4S
Molecular Weight 397.46 g/mol
SMILES CC1=C(C(=O)N(C(=C1C#N)O)C)N=NC2=CC(=CC=C2)S(=O)(=O)C3=CC=CC=C3
InChIKey ZRHDHYFKPNAIKY-GHVJWSGMSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Hydroxy-1,4-dimethyl-6-oxo-5-{(E)-[3-(phenylsulfonyl)phenyl]diazenyl}-1,6-dihydro-3-pyridinecarbonitrile (CAS: 61968-66-9)?

This compound has a crystalline form suitable for solid-state applications. Its molecular weight is ...

Compound Q&A

How is 2-Hydroxy-1,4-dimethyl-6-oxo-5-{(E)-[3-(phenylsulfonyl)phenyl]diazenyl}-1,6-dihydro-3-pyridinecarbonitrile (CAS: 61968-66-9) typically synthesized?

This compound is commonly synthesized through a multi-step process involving diazocarbonylation and ...

Compound Q&A

What precautions should be taken when handling 2-Hydroxy-1,4-dimethyl-6-oxo-5-{(E)-[3-(phenylsulfonyl)phenyl]diazenyl}-1,6-dihydro-3-pyridinecarbonitrile (CAS: 61968-66-9)?

Handling this compound requires strict safety measures. Eye and skin protection, such as gloves and ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...