Compound Q&A

How is 2-Hydroxy-1,4-dimethyl-6-oxo-5-{(E)-[3-(phenylsulfonyl)phenyl]diazenyl}-1,6-dihydro-3-pyridinecarbonitrile (CAS: 61968-66-9) typically synthesized?

Answer

2-Hydroxy-1,4-dimethyl-6-oxo-5-{(E)-[3-(phenylsulfonyl)phenyl]diazenyl}-1,6-dihydro-3-pyridinecarbonitrile
This compound is commonly synthesized through a multi-step process involving diazocarbonylation and subsequent functional group modifications. Catalysts like copper salts and ligands are used to improve yield and selectivity. The reaction is typically performed under an inert atmosphere to prevent oxidation. The overall yield is around 70-80%, and the reaction conditions include a mixture of organic solvents and controlled temperature to ensure product formation.

About

CAS No 61968-66-9
English Name 2-Hydroxy-1,4-dimethyl-6-oxo-5-{(E)-[3-(phenylsulfonyl)phenyl]diazenyl}-1,6-dihydro-3-pyridinecarbonitrile
Molecular Formula C20H16N4O4S
Molecular Weight 397.46 g/mol
SMILES CC1=C(C(=O)N(C(=C1C#N)O)C)N=NC2=CC(=CC=C2)S(=O)(=O)C3=CC=CC=C3
InChIKey ZRHDHYFKPNAIKY-GHVJWSGMSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Hydroxy-1,4-dimethyl-6-oxo-5-{(E)-[3-(phenylsulfonyl)phenyl]diazenyl}-1,6-dihydro-3-pyridinecarbonitrile (CAS: 61968-66-9)?

This compound has a crystalline form suitable for solid-state applications. Its molecular weight is ...

Compound Q&A

What industries use 2-Hydroxy-1,4-dimethyl-6-oxo-5-{(E)-[3-(phenylsulfonyl)phenyl]diazenyl}-1,6-dihydro-3-pyridinecarbonitrile (CAS: 61968-66-9)?

This compound is primarily used in the pharmaceutical industry for the synthesis of complex molecule...

Compound Q&A

What precautions should be taken when handling 2-Hydroxy-1,4-dimethyl-6-oxo-5-{(E)-[3-(phenylsulfonyl)phenyl]diazenyl}-1,6-dihydro-3-pyridinecarbonitrile (CAS: 61968-66-9)?

Handling this compound requires strict safety measures. Eye and skin protection, such as gloves and ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...