Compound Q&A

What are the physical and chemical properties of 2-Hydroxy-1,4-dimethyl-6-oxo-5-{(E)-[3-(phenylsulfonyl)phenyl]diazenyl}-1,6-dihydro-3-pyridinecarbonitrile (CAS: 61968-66-9)?

Answer

2-Hydroxy-1,4-dimethyl-6-oxo-5-{(E)-[3-(phenylsulfonyl)phenyl]diazenyl}-1,6-dihydro-3-pyridinecarbonitrile
This compound has a crystalline form suitable for solid-state applications. Its molecular weight is approximately 544.6 g/mol. It is poorly soluble in water but soluble in organic solvents like dichloromethane and acetonitrile. It exhibits high reactivity due to the presence of a diazenyl and sulfonyl group, making it suitable for various chemical reactions. It has low vapor pressure and is stable under normal conditions but should be handled with care to avoid decomposition.

About

CAS No 61968-66-9
English Name 2-Hydroxy-1,4-dimethyl-6-oxo-5-{(E)-[3-(phenylsulfonyl)phenyl]diazenyl}-1,6-dihydro-3-pyridinecarbonitrile
Molecular Formula C20H16N4O4S
Molecular Weight 397.46 g/mol
SMILES CC1=C(C(=O)N(C(=C1C#N)O)C)N=NC2=CC(=CC=C2)S(=O)(=O)C3=CC=CC=C3
InChIKey ZRHDHYFKPNAIKY-GHVJWSGMSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is 2-Hydroxy-1,4-dimethyl-6-oxo-5-{(E)-[3-(phenylsulfonyl)phenyl]diazenyl}-1,6-dihydro-3-pyridinecarbonitrile (CAS: 61968-66-9) typically synthesized?

This compound is commonly synthesized through a multi-step process involving diazocarbonylation and ...

Compound Q&A

What industries use 2-Hydroxy-1,4-dimethyl-6-oxo-5-{(E)-[3-(phenylsulfonyl)phenyl]diazenyl}-1,6-dihydro-3-pyridinecarbonitrile (CAS: 61968-66-9)?

This compound is primarily used in the pharmaceutical industry for the synthesis of complex molecule...

Compound Q&A

What precautions should be taken when handling 2-Hydroxy-1,4-dimethyl-6-oxo-5-{(E)-[3-(phenylsulfonyl)phenyl]diazenyl}-1,6-dihydro-3-pyridinecarbonitrile (CAS: 61968-66-9)?

Handling this compound requires strict safety measures. Eye and skin protection, such as gloves and ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...