Compound Q&A

What industries use 4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid (CAS: 72570-70-8)?

Answer

4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid
4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid is primarily used in the pharmaceutical industry for the synthesis of drug intermediates. It also finds applications in the polymer industry for developing new materials with specific properties. Additionally, it is used in the production of sensors and semiconductors due to its unique chemical properties.

About

CAS No 72570-70-8
English Name 4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid
Molecular Formula C13H19NO4
Molecular Weight 253.3 g/mol
SMILES CC(C)NCC(COC1=CC=C(C=C1)C(=O)O)O
InChIKey WONQRVASZHJNFS-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid (CAS: 72570-70-8)?

4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid is a white crystalline solid with a molecular we...

Compound Q&A

How is 4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid (CAS: 72570-70-8) typically synthesized?

4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid is synthesized by first preparing the correspond...

Compound Q&A

What precautions should be taken when handling 4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid (CAS: 72570-70-8)?

Proper personal protective equipment (PPE) should be worn when handling 4-[2-Hydroxy-3-(isopropylami...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...