Compound Q&A

How is 4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid (CAS: 72570-70-8) typically synthesized?

Answer

4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid
4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid is synthesized by first preparing the corresponding 3-(isopropylamino)propyl chloride from isopropylamine and chloropropanol. This halide is then reacted with 2-hydroxybenzoic acid in the presence of a base like triethylamine to form the desired acid. The reaction is carried out under mild conditions to ensure high yield and selectivity.

About

CAS No 72570-70-8
English Name 4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid
Molecular Formula C13H19NO4
Molecular Weight 253.3 g/mol
SMILES CC(C)NCC(COC1=CC=C(C=C1)C(=O)O)O
InChIKey WONQRVASZHJNFS-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid (CAS: 72570-70-8)?

4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid is a white crystalline solid with a molecular we...

Compound Q&A

What industries use 4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid (CAS: 72570-70-8)?

4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid (CAS: 72570-70-8)?

Proper personal protective equipment (PPE) should be worn when handling 4-[2-Hydroxy-3-(isopropylami...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...