Compound Q&A

What are the physical and chemical properties of 4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid (CAS: 72570-70-8)?

Answer

4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid
4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid is a white crystalline solid with a molecular weight of approximately 319.41 g/mol. It is slightly soluble in water and has good solubility in organic solvents like methanol and ethanol. Its reactivity is moderate, with potential for esterification and other functional group modifications. It is stable under normal storage conditions but may react with strong acids or bases.

About

CAS No 72570-70-8
English Name 4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid
Molecular Formula C13H19NO4
Molecular Weight 253.3 g/mol
SMILES CC(C)NCC(COC1=CC=C(C=C1)C(=O)O)O
InChIKey WONQRVASZHJNFS-UHFFFAOYSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is 4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid (CAS: 72570-70-8) typically synthesized?

4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid is synthesized by first preparing the correspond...

Compound Q&A

What industries use 4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid (CAS: 72570-70-8)?

4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 4-[2-Hydroxy-3-(isopropylamino)propoxy]benzoic acid (CAS: 72570-70-8)?

Proper personal protective equipment (PPE) should be worn when handling 4-[2-Hydroxy-3-(isopropylami...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...