Compound Q&A

What industries use trans-1-Amino-1,3-cyclobutanedicarboxylic acid (CAS: 73550-55-7)?

Answer

trans-1-Amino-1,3-cyclobutanedicarboxylic acid
Trans-1-Amino-1,3-cyclobutanedicarboxylic acid is utilized in the pharmaceutical industry for the synthesis of certain drugs. It is also used in the polymer industry to produce high-performance polymers with specific properties. Additionally, it finds applications in the production of sensors and semiconductors due to its unique chemical structure.

About

CAS No 73550-55-7
English Name trans-1-Amino-1,3-cyclobutanedicarboxylic acid
Molecular Formula C6H9NO4
Molecular Weight 159.14 g/mol
SMILES N[C@]1(C[C@H](C1)C(=O)O)C(=O)O
InChIKey GGMYWPBNZXRMME-HSRNZHMGSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of trans-1-Amino-1,3-cyclobutanedicarboxylic acid (CAS: 73550-55-7)?

Trans-1-Amino-1,3-cyclobutanedicarboxylic acid is a solid with a crystalline form at room temperatur...

Compound Q&A

How is trans-1-Amino-1,3-cyclobutanedicarboxylic acid (CAS: 73550-55-7) typically synthesized?

Trans-1-Amino-1,3-cyclobutanedicarboxylic acid can be synthesized through a multistep process involv...

Compound Q&A

What precautions should be taken when handling trans-1-Amino-1,3-cyclobutanedicarboxylic acid (CAS: 73550-55-7)?

When handling trans-1-Amino-1,3-cyclobutanedicarboxylic acid, it is important to use appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...