Compound Q&A

What are the physical and chemical properties of trans-1-Amino-1,3-cyclobutanedicarboxylic acid (CAS: 73550-55-7)?

Answer

trans-1-Amino-1,3-cyclobutanedicarboxylic acid
Trans-1-Amino-1,3-cyclobutanedicarboxylic acid is a solid with a crystalline form at room temperature. Its molecular weight is approximately 150.14 g/mol. This compound is slightly soluble in water but more soluble in organic solvents. It has moderate reactivity with carboxylic acid derivatives, and it can form esters and anhydrides under certain conditions. Additionally, it can react with amines to form amides.

About

CAS No 73550-55-7
English Name trans-1-Amino-1,3-cyclobutanedicarboxylic acid
Molecular Formula C6H9NO4
Molecular Weight 159.14 g/mol
SMILES N[C@]1(C[C@H](C1)C(=O)O)C(=O)O
InChIKey GGMYWPBNZXRMME-HSRNZHMGSA-N
Last Updated: 2026-01-04 19:14

Related Q&A

Compound Q&A

How is trans-1-Amino-1,3-cyclobutanedicarboxylic acid (CAS: 73550-55-7) typically synthesized?

Trans-1-Amino-1,3-cyclobutanedicarboxylic acid can be synthesized through a multistep process involv...

Compound Q&A

What industries use trans-1-Amino-1,3-cyclobutanedicarboxylic acid (CAS: 73550-55-7)?

Trans-1-Amino-1,3-cyclobutanedicarboxylic acid is utilized in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling trans-1-Amino-1,3-cyclobutanedicarboxylic acid (CAS: 73550-55-7)?

When handling trans-1-Amino-1,3-cyclobutanedicarboxylic acid, it is important to use appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...