Compound Q&A

How should [compound name] (CAS: 112825-05-5) be stored?

Answer

[(1alpha,6beta,14alpha,16beta,17xi)-20-Ethyl-7,8-dihydroxy-1,6,14,16-tetramethoxyaconitan-4-yl]methyl 2-[(3S)-3-methyl-2,5-dioxo-1-pyrrolidinyl]benzoate 2-hydroxy-1,2,3-propanetricarboxylate (1:1)
[Compound name] (CAS: 112825-05-5) should be stored in a cool, dry place away from direct sunlight and moisture. Use a sealed container to prevent degradation. It is recommended to store it at a temperature not exceeding 25°C and avoid exposure to high humidity to maintain its stability and effectiveness.

About

English Name [(1alpha,6beta,14alpha,16beta,17xi)-20-Ethyl-7,8-dihydroxy-1,6,14,16-tetramethoxyaconitan-4-yl]methyl 2-[(3S)-3-methyl-2,5-dioxo-1-pyrrolidinyl]benzoate 2-hydroxy-1,2,3-propanetricarboxylate (1:1)
Molecular Formula C43H58N2O17
Molecular Weight 874.93 g/mol
SMILES CCN1CC2(CCC(C34C2C(C(C31)(C5(CC(C6CC4C5C6OC)OC)O)O)OC)OC)COC(=O)C7=CC=CC=C7N8C(=O)CC(C8=O)C.C(C(=O)O)C(CC(=O)O)(C(=O)O)O
InChIKey INBLZNJHDLEWPS-DDIMIZGISA-N
Last Updated: 2026-01-04 05:07

Related Q&A

Compound Q&A

What is [compound name] (CAS: 112825-05-5)?

[Compound name] (CAS: 112825-05-5) is a complex organic compound with a unique chemical structure. I...

Compound Q&A

What are the main uses of [compound name] (CAS: 112825-05-5)?

[Compound name] (CAS: 112825-05-5) is primarily used in pharmaceuticals for its biological activity,...

Compound Q&A

Is [compound name] (CAS: 112825-05-5) safe?

Yes, [compound name] (CAS: 112825-05-5) is generally considered safe under proper handling condition...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...