Compound Q&A

Is [compound name] (CAS: 112825-05-5) safe?

Answer

[(1alpha,6beta,14alpha,16beta,17xi)-20-Ethyl-7,8-dihydroxy-1,6,14,16-tetramethoxyaconitan-4-yl]methyl 2-[(3S)-3-methyl-2,5-dioxo-1-pyrrolidinyl]benzoate 2-hydroxy-1,2,3-propanetricarboxylate (1:1)
Yes, [compound name] (CAS: 112825-05-5) is generally considered safe under proper handling conditions. However, users should be cautious of potential skin and eye irritation. Protective measures such as gloves and safety goggles are recommended to minimize exposure. Follow all safety guidelines provided in the material safety data sheet (MSDS).

About

English Name [(1alpha,6beta,14alpha,16beta,17xi)-20-Ethyl-7,8-dihydroxy-1,6,14,16-tetramethoxyaconitan-4-yl]methyl 2-[(3S)-3-methyl-2,5-dioxo-1-pyrrolidinyl]benzoate 2-hydroxy-1,2,3-propanetricarboxylate (1:1)
Molecular Formula C43H58N2O17
Molecular Weight 874.93 g/mol
SMILES CCN1CC2(CCC(C34C2C(C(C31)(C5(CC(C6CC4C5C6OC)OC)O)O)OC)OC)COC(=O)C7=CC=CC=C7N8C(=O)CC(C8=O)C.C(C(=O)O)C(CC(=O)O)(C(=O)O)O
InChIKey INBLZNJHDLEWPS-DDIMIZGISA-N
Last Updated: 2026-01-04 05:07

Related Q&A

Compound Q&A

What is [compound name] (CAS: 112825-05-5)?

[Compound name] (CAS: 112825-05-5) is a complex organic compound with a unique chemical structure. I...

Compound Q&A

What are the main uses of [compound name] (CAS: 112825-05-5)?

[Compound name] (CAS: 112825-05-5) is primarily used in pharmaceuticals for its biological activity,...

Compound Q&A

How should [compound name] (CAS: 112825-05-5) be stored?

[Compound name] (CAS: 112825-05-5) should be stored in a cool, dry place away from direct sunlight a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...